
CAS 93476-41-6
:3-Hydroxy-1,4-dimethyl-2(1H)-quinolinone
Description:
3-Hydroxy-1,4-dimethyl-2(1H)-quinolinone, with the CAS number 93476-41-6, is a chemical compound that belongs to the quinolinone family, characterized by a fused bicyclic structure containing a quinoline moiety. This compound typically exhibits a hydroxyl group at the 3-position and two methyl groups at the 1 and 4 positions of the quinolinone ring. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, which make it of interest in medicinal chemistry. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the methyl groups can influence its lipophilicity and overall reactivity. Additionally, the compound may participate in various chemical reactions, such as oxidation and substitution, due to the functional groups present. Its unique structure and properties make it a subject of research in various fields, including pharmaceuticals and organic synthesis.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c1-7-8-5-3-4-6-9(8)12(2)11(14)10(7)13/h3-6,13H,1-2H3
InChI key:InChIKey=DYNHUKPXYPGLNH-UHFFFAOYSA-N
SMILES:CC=1C=2C(N(C)C(=O)C1O)=CC=CC2
Synonyms:- Carbostyril, 3-hydroxy-1,4-dimethyl-
- 3-Hydroxy-1,4-dimethyl-1,2-dihydroquinolin-2-one
- 2(1H)-Quinolinone, 3-hydroxy-1,4-dimethyl-
- 3-Hydroxy-1,4-dimethyl-2(1H)-quinolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
