CAS 93483-94-4
:2-(3-bromopropyl)-1H-benzimidazole
Description:
2-(3-Bromopropyl)-1H-benzimidazole is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of a 3-bromopropyl substituent enhances its reactivity and solubility in organic solvents. This compound typically exhibits properties such as moderate to high melting and boiling points, influenced by its molecular weight and structure. It may also display biological activity, making it of interest in pharmaceutical research. The bromine atom can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which can be exploited in synthetic organic chemistry. Additionally, the compound's structure suggests potential interactions with biological targets, which could be relevant for drug development. Safety data should be consulted, as halogenated compounds can pose health risks. Overall, 2-(3-bromopropyl)-1H-benzimidazole is a versatile compound with applications in medicinal chemistry and material science.
Formula:C10H11BrN2
InChI:InChI=1/C10H11BrN2/c11-7-3-6-10-12-8-4-1-2-5-9(8)13-10/h1-2,4-5H,3,6-7H2,(H,12,13)
SMILES:c1ccc2c(c1)nc(CCCBr)[nH]2
Synonyms:- 1H-benzimidazole, 2-(3-bromopropyl)-
- 2-(3-Brompropyl)-1H-benzimidazol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
