CAS 93496-44-7
:N-[(2S,3S,4R,5R)-2-benzyloxy-4,5-dihydroxy-6-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-3-yl]acetamide
Description:
The chemical substance N-[(2S,3S,4R,5R)-2-benzyloxy-4,5-dihydroxy-6-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-3-yl]acetamide, with CAS number 93496-44-7, is a complex organic compound characterized by its intricate structure featuring multiple stereocenters and functional groups. It contains two tetrahydropyran rings, which are cyclic ethers that contribute to its overall stability and reactivity. The presence of hydroxyl (-OH) groups indicates that the compound is likely to exhibit strong hydrogen bonding capabilities, influencing its solubility and interaction with biological systems. The benzyloxy group suggests potential for aromatic interactions, while the acetamide moiety may enhance its biological activity. This compound is likely to be of interest in medicinal chemistry due to its structural complexity and potential pharmacological properties. Its synthesis and characterization would require advanced organic chemistry techniques, and it may serve as a lead compound for further drug development or as a biochemical probe in research settings.
Formula:C21H31NO11
InChI:InChI=1/C21H31NO11/c1-10(24)22-14-17(27)16(26)13(33-20(14)30-8-11-5-3-2-4-6-11)9-31-21-19(29)18(28)15(25)12(7-23)32-21/h2-6,12-21,23,25-29H,7-9H2,1H3,(H,22,24)/t12?,13?,14-,15-,16-,17+,18-,19-,20-,21+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzyl 2-acetamido-2-deoxy-6-O-(β-D-galactopyranosyl)-α-D-galactopyranoside
CAS:Molecular weight:473.47Benzyl 2-acetamido-2-deoxy-6-O-(b-D-galactopyranosyl)-a-D-galactopyranoside
CAS:<p>This compound is a custom synthesis. It is an oligosaccharide, polysaccharide and modification of saccharides. The compound has been modified with methylation, glycosylation, and fluorination. This compound is a high purity product with the CAS number 93496-44-7.</p>Formula:C21H31NO11Purity:Min. 95%Color and Shape:PowderMolecular weight:473.47 g/molBenzyl 2-Acetamido-2-deoxy-6-O-(β-D-galactopyranosyl)-α-D-galactopyranoside
CAS:Controlled ProductFormula:C21H31NO11Color and Shape:NeatMolecular weight:473.47


