CAS 935-64-8
:1-phenylcyclobutanol
Description:
1-Phenylcyclobutanol is an organic compound characterized by a cyclobutane ring substituted with a phenyl group and a hydroxyl group. Its molecular structure features a four-membered cyclobutane ring, which contributes to its unique physical and chemical properties. The presence of the hydroxyl (-OH) group makes it an alcohol, influencing its solubility and reactivity. Typically, 1-phenylcyclobutanol is a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits moderate polarity due to the hydroxyl group, allowing it to engage in hydrogen bonding, which affects its boiling and melting points. This compound is of interest in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and fine chemicals. Additionally, its stereochemistry can lead to interesting conformational behaviors, impacting its reactivity and interactions with other molecules. As with many organic compounds, safety precautions should be observed when handling 1-phenylcyclobutanol, as it may pose health risks if ingested or inhaled.
Formula:C10H12O
InChI:InChI=1/C10H12O/c11-10(7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6,11H,4,7-8H2
SMILES:c1ccc(cc1)C1(CCC1)O
Synonyms:- Cyclobutanol, 1-phenyl-
- 1-Phenylcyclobutanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Phenylcyclobutan-1-ol
CAS:<p>1-Phenylcyclobutan-1-ol is a functional group that is used in the production of cyclopentyl and cyclobutanol. It has been shown to be an alkylating agent that can react with the -OH group on another molecule, forming a C-O bond between them. This type of reaction is called a ring opening, which can lead to stabilization of the molecule. 1-Phenylcyclobutan-1-ol also reacts with ammonium nitrate in an elimination reaction to form an aldimine, which can then dissociate into two molecules of ammonia and one molecule of water. The end result is the formation of ammonia and water.</p>Formula:C10H12OPurity:Min. 95%Molecular weight:148.2 g/mol
