CAS 93516-03-1
:7-(Trifluoromethyl)-4(1H)-quinolinone
Description:
7-(Trifluoromethyl)-4(1H)-quinolinone is a chemical compound characterized by its quinolinone structure, which consists of a fused benzene and pyridine ring system. The presence of a trifluoromethyl group (-CF3) at the 7-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its applications in medicinal chemistry, particularly as a scaffold for the development of pharmaceuticals due to its ability to interact with various biological targets. The trifluoromethyl group can also enhance metabolic stability and influence the compound's pharmacokinetics. Additionally, 7-(Trifluoromethyl)-4(1H)-quinolinone may exhibit interesting photophysical properties, making it a subject of interest in materials science and organic electronics. As with many fluorinated compounds, it is essential to handle it with care, considering potential environmental and health impacts associated with fluorinated substances.
Formula:C10H6F3NO
InChI:InChI=1S/C10H6F3NO/c11-10(12,13)6-1-2-7-8(5-6)14-4-3-9(7)15/h1-5H,(H,14,15)
InChI key:InChIKey=OWPLFJSQLPTCHS-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(C(F)(F)F)=CC2)NC=C1
Synonyms:- 4(1H)-Quinolinone, 7-(trifluoromethyl)-
- 7-(Trifluoromethyl)-4-quinolone
- 7-(Trifluoromethyl)-4(1H)-quinolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.