CAS 93517-76-1
:4-(2,5-dimethylphenyl)phthalazin-1(2H)-one
Description:
4-(2,5-Dimethylphenyl)phthalazin-1(2H)-one is an organic compound characterized by its phthalazinone structure, which features a phthalazine ring system fused with a carbonyl group. This compound typically exhibits a solid state at room temperature and is likely to be a crystalline substance. The presence of the 2,5-dimethylphenyl group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents rather than in water. The compound may exhibit various functional properties, including potential biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, such as electrophilic substitutions or nucleophilic additions, due to the presence of both aromatic and carbonyl functionalities. Additionally, the compound's stability and reactivity can be influenced by the substituents on the phenyl ring, which can affect its electronic properties. Overall, 4-(2,5-dimethylphenyl)phthalazin-1(2H)-one is a compound of interest in organic chemistry and medicinal chemistry contexts.
Formula:C16H14N2O
InChI:InChI=1/C16H14N2O/c1-10-7-8-11(2)14(9-10)15-12-5-3-4-6-13(12)16(19)18-17-15/h3-9H,1-2H3,(H,18,19)
SMILES:Cc1ccc(C)c(c1)c1c2ccccc2c(nn1)O
Synonyms:- 4-(2,5-Dimethyl-phenyl)-2H-phthalazin-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
