CAS 935250-69-4
:4-fluoro-1H-indazol-5-amine
Description:
4-Fluoro-1H-indazol-5-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 4-position and an amino group at the 5-position of the indazole ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. It is often studied in medicinal chemistry for its potential biological activities, including its role as a building block in the synthesis of pharmaceuticals. The compound's reactivity can be influenced by the electron-withdrawing nature of the fluorine atom, which may affect its interactions with biological targets. Additionally, its structural features may allow for various modifications, making it a versatile candidate for further chemical exploration and development in drug discovery.
Formula:C7H6FN3
InChI:InChI=1/C7H6FN3/c8-7-4-3-10-11-6(4)2-1-5(7)9/h1-3H,9H2,(H,10,11)
SMILES:c1cc2c(c[nH]n2)c(c1N)F
Synonyms:- 5-AMINO-4-FLUORO 1H-INDAZOLE
- 4-fluoro-1H-indazol-5-amine
- INDAZOL-5-AMINE, 4-FLUORO
- 1H-Indazol-5-amine, 4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
