CAS 935260-60-9
:3-Fluoro-1-piperidinamine
Description:
3-Fluoro-1-piperidinamine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a fluorine atom at the third position of the piperidine ring distinguishes it from other derivatives. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The fluorine substituent can enhance lipophilicity and may affect the compound's biological activity, making it of interest in medicinal chemistry and drug development. 3-Fluoro-1-piperidinamine may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the presence of the amine functional group. Its specific applications and behavior in biological systems would depend on its structural characteristics and the context of its use, particularly in pharmaceutical research where it may serve as a building block for more complex molecules.
Formula:C5H11FN2
InChI:InChI=1S/C5H11FN2/c6-5-2-1-3-8(7)4-5/h5H,1-4,7H2
InChI key:InChIKey=NITPPSSHSNSDOU-UHFFFAOYSA-N
SMILES:FC1CN(N)CCC1
Synonyms:- 3-Fluoro-1-piperidinamine
- 1-Piperidinamine, 3-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.