CAS 935260-92-7
:1-[[4-(3-Methoxypropoxy)-3-methyl-2-pyridinyl]methyl]-2-[[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methyl]sulfinyl]-1H-benzimidazole
Description:
The chemical substance known as 1-[[4-(3-Methoxypropoxy)-3-methyl-2-pyridinyl]methyl]-2-[[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methyl]sulfinyl]-1H-benzimidazole, with the CAS number 935260-92-7, is a complex organic compound characterized by its unique structural features. It contains a benzimidazole core, which is a bicyclic structure known for its biological activity, particularly in pharmaceuticals. The presence of methoxypropoxy and methyl-pyridine substituents suggests potential interactions with biological targets, possibly influencing its pharmacological properties. The sulfinyl group indicates the presence of sulfur, which can enhance the compound's reactivity and stability. This compound may exhibit properties such as solubility in organic solvents, moderate to high molecular weight, and potential bioactivity, making it of interest in medicinal chemistry. Its specific applications and efficacy would depend on further studies, including pharmacokinetics and toxicity assessments. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in drug development.
Formula:C29H36N4O5S
InChI:InChI=1/C29H36N4O5S/c1-21-24(30-13-11-27(21)37-17-7-15-35-3)19-33-26-10-6-5-9-23(26)32-29(33)39(34)20-25-22(2)28(12-14-31-25)38-18-8-16-36-4/h5-6,9-14H,7-8,15-20H2,1-4H3
SMILES:Cc1c(Cn2c3ccccc3nc2S(=O)Cc2c(C)c(ccn2)OCCCOC)nccc1OCCCOC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Rabeprazole Impurity 9
CAS:Formula:C29H36N4O5SColor and Shape:Pale Brown LiquidMolecular weight:552.69


