CAS 935272-19-8
:5-chloro-6-fluoroindoline
Description:
5-Chloro-6-fluoroindoline is a chemical compound characterized by its indoline structure, which consists of a fused benzene and pyrrole ring. The presence of chlorine and fluorine substituents at the 5 and 6 positions, respectively, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents, due to the influence of halogen substituents on biological activity. Additionally, the presence of these halogens can enhance the compound's lipophilicity, potentially affecting its pharmacokinetics. As with many halogenated compounds, 5-chloro-6-fluoroindoline may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic electronics. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C8H7ClFN
InChI:InChI=1/C8H7ClFN/c9-6-3-5-1-2-11-8(5)4-7(6)10/h3-4,11H,1-2H2
SMILES:C1CNc2cc(c(cc12)Cl)F
Synonyms:- 1H-indole, 5-chloro-6-fluoro-2,3-dihydro-
- 5-Chlor-6-fluorindolin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
