CymitQuimica logo

CAS 935273-85-1

:

N-Hydroxy-4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-yl]bicyclo[2.2.2]octane-1-carboximidamide

Description:
N-Hydroxy-4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-yl]bicyclo[2.2.2]octane-1-carboximidamide, with CAS number 935273-85-1, is a complex organic compound characterized by its bicyclic structure and the presence of multiple functional groups. This substance features a bicyclo[2.2.2]octane core, which contributes to its unique three-dimensional shape and potential steric effects. The presence of a hydroxyl group (N-hydroxy) and a carboximidamide moiety indicates potential reactivity and biological activity, possibly influencing its solubility and interaction with biological targets. The incorporation of a trifluoromethyl group enhances lipophilicity and may improve the compound's pharmacokinetic properties. Additionally, the triazole ring is known for its role in various biological activities, including antifungal and anticancer properties. Overall, this compound's structural complexity and functional diversity suggest potential applications in medicinal chemistry and drug development, although specific biological activities and properties would require further investigation through experimental studies.
Formula:C19H22F3N5O
InChI:InChI=1S/C19H22F3N5O/c1-27-14(12-4-2-3-5-13(12)19(20,21)22)24-25-16(27)18-9-6-17(7-10-18,8-11-18)15(23)26-28/h2-5,28H,6-11H2,1H3,(H2,23,26)
InChI key:InChIKey=DKRYWCZWYJYQAM-UHFFFAOYSA-N
SMILES:CN1C(C23CCC(C(NO)=N)(CC2)CC3)=NN=C1C4=C(C(F)(F)F)C=CC=C4
Synonyms:
  • N-Hydroxy-4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-yl]bicyclo[2.2.2]octane-1-carboximidamide
  • Bicyclo[2.2.2]octane-1-carboximidamide, N-hydroxy-4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.