CAS 935475-85-7

3-(2,5-Dichlorophenyl)-2-propynoic acid

Description:

3-(2,5-Dichlorophenyl)-2-propynoic acid is an organic compound characterized by its unique structure, which includes a propynoic acid moiety and a dichlorophenyl group. This compound features a triple bond between the second and third carbon atoms of the propynoic acid, contributing to its reactivity and potential applications in organic synthesis. The presence of two chlorine atoms on the phenyl ring enhances its electrophilic character, making it useful in various chemical reactions, including substitution and coupling reactions. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic ring, while its acidic carboxylic group can engage in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the dichlorophenyl substituent may impart specific biological activities, making it of interest in pharmaceutical research. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact. Overall, 3-(2,5-Dichlorophenyl)-2-propynoic acid represents a versatile building block in synthetic organic chemistry.

Formula: C₉H₄Cl₂O₂

InChI: InChI=1S/C9H4Cl2O2/c10-7-2-3-8(11)6(5-7)1-4-9(12)13/h2-3,5H,(H,12,13)

InChI key: InChIKey=CLMBHKLJUVAMQZ-UHFFFAOYSA-N

SMILES: C(#CC(O)=O)C1=C(Cl)C=CC(Cl)=C1

Synonyms:

• 3-(2,5-Dichlorophenyl)-2-propynoic acid
• 2-Propynoic acid, 3-(2,5-dichlorophenyl)-