CAS 93549-15-6
:3,4-Dihydro-6-methoxyisoquinoline hydrochloride
Description:
3,4-Dihydro-6-methoxyisoquinoline hydrochloride is a chemical compound characterized by its isoquinoline structure, which features a bicyclic arrangement of carbon atoms. This compound typically exhibits a pale yellow to off-white crystalline appearance. The presence of a methoxy group (-OCH3) at the 6-position contributes to its solubility and reactivity, while the dihydro form indicates the saturation of the ring system, affecting its chemical properties and potential biological activity. As a hydrochloride salt, it is often more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological activities, including potential effects on the central nervous system, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which can be explored in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C10H12ClNO
InChI:InChI=1/C10H11NO.ClH/c1-12-10-3-2-9-7-11-5-4-8(9)6-10;/h2-3,6-7H,4-5H2,1H3;1H
SMILES:COc1ccc2C=NCCc2c1.Cl
Synonyms:- 6-Methoxy-3,4-dihydroisoquinoline hydrochloride
- 6-Methoxy-3,4-dihydroisoquinoline hydrochloride (1:1)
- Isoquinoline, 3,4-Dihydro-6-Methoxy-, Hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,4-Dihydro-6-methoxyisoquinoline Hydrochloride
CAS:Controlled ProductFormula:C10H11NO•HClColor and Shape:NeatMolecular weight:161.20 +(36.46)

