CAS 935521-29-2
:(1Z)-1-(1(3H)-Isobenzofuranylidene)-2-propanone
Description:
(1Z)-1-(1(3H)-Isobenzofuranylidene)-2-propanone, identified by its CAS number 935521-29-2, is an organic compound characterized by its unique structural features. It contains a propanone moiety, which is a ketone functional group, and is substituted with an isobenzofuran moiety that contributes to its aromatic properties. The presence of the isobenzofuran ring system imparts distinct electronic characteristics, potentially influencing its reactivity and interaction with other chemical species. This compound may exhibit properties typical of both ketones and aromatic compounds, such as stability under certain conditions and potential for electrophilic substitution reactions. Its Z-configuration indicates a specific geometric arrangement around the double bond, which can affect its physical properties, such as melting and boiling points, as well as its solubility in various solvents. Due to its structural complexity, this compound may have applications in organic synthesis, medicinal chemistry, or materials science, although specific applications would depend on further research into its reactivity and biological activity.
Formula:C11H10O2
InChI:InChI=1S/C11H10O2/c1-8(12)6-11-10-5-3-2-4-9(10)7-13-11/h2-6H,7H2,1H3/b11-6-
InChI key:InChIKey=RBHHGDADHCEGTP-WDZFZDKYSA-N
SMILES:C(\C(C)=O)=C\1/C=2C(CO1)=CC=CC2
Synonyms:- 2-Propanone, 1-(1(3H)-isobenzofuranylidene)-, (1Z)-
- (1Z)-1-(1(3H)-Isobenzofuranylidene)-2-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.