CAS 935534-21-7

Ethanone, 2,2,2-trifluoro-1-(2-hydroxy-4-methylphenyl)-

Description:

Ethanone, 2,2,2-trifluoro-1-(2-hydroxy-4-methylphenyl)-, also known by its CAS number 935534-21-7, is an organic compound characterized by the presence of a trifluoromethyl group and a hydroxyl group attached to a phenyl ring. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The hydroxyl group provides hydrogen bonding capabilities, which can affect solubility and interaction with biological targets. The presence of the methyl group on the phenyl ring can also influence the compound's steric and electronic properties. Overall, this compound may exhibit unique physical and chemical properties, making it suitable for research in pharmaceuticals, agrochemicals, or materials science. However, specific data regarding its melting point, boiling point, and other physical properties would require further investigation or reference to specialized databases.

Formula: C₉H₇F₃O₂

InChI: InChI=1S/C9H7F3O2/c1-5-2-3-6(7(13)4-5)8(14)9(10,11)12/h2-4,13H,1H3

InChI key: InChIKey=FBZHWPJYAXFCFG-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C1=C(O)C=C(C)C=C1

Synonyms:

• Ethanone, 2,2,2-trifluoro-1-(2-hydroxy-4-methylphenyl)-
• 2,2,2-Trifluoro-1-(2-hydroxy-4-methylphenyl)ethanone