CymitQuimica logo

CAS 935534-39-7

:

2-Bromo-5-fluoropyridine 1-oxide

Description:
2-Bromo-5-fluoropyridine 1-oxide is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and fluorine atoms, as well as a nitrogen-oxide functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. The presence of the bromine and fluorine substituents can influence its reactivity, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. The nitrogen-oxide group contributes to its potential as a ligand in coordination chemistry and may also affect its electronic properties. Additionally, 2-Bromo-5-fluoropyridine 1-oxide can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the electrophilic nature of the halogen substituents. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound serves as a valuable building block in organic synthesis and materials science.
Formula:C5H3BrFNO
InChI:InChI=1S/C5H3BrFNO/c6-5-2-1-4(7)3-8(5)9/h1-3H
InChI key:RDZPKTQDXLFGTQ-UHFFFAOYSA-N
SMILES:C1=CC(=[N+](C=C1F)[O-])Br
Synonyms:
  • 2-bromo-5-fluoro-1-oxidopyridin-1-ium
  • Pyridine, 2-bromo-5-fluoro-, 1-oxide
  • 2-Bromo-5-fluoropyridine 1-oxide
Found 4 products.