CAS 93560-55-5
:2-Iodo-3-methoxypyridine
Description:
2-Iodo-3-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an iodine atom at the 2-position and a methoxy group (-OCH3) at the 3-position of the pyridine ring significantly influences its chemical properties and reactivity. This compound is typically a pale yellow to brown solid, and it is soluble in organic solvents such as ethanol and dichloromethane, but less soluble in water due to its hydrophobic nature. 2-Iodo-3-methoxypyridine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its iodine substituent can also serve as a leaving group in reactions, enhancing its utility in synthesis. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and interaction with biological targets.
Formula:C6H6INO
InChI:InChI=1/C6H6INO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3
SMILES:COc1cccnc1I
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Iodo-3-methoxypyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H6INOPurity:97%Color and Shape:White to cream to brown, Crystals or powder or crystalline powderMolecular weight:235.022-Iodo-3-methoxypyridine
CAS:Formula:C6H6INOPurity:98%Color and Shape:LiquidMolecular weight:235.0224



