CAS 93560-60-2
:2-Bromo-3-(tetrahydro-2-pyranyloxy)pyridine
Description:
2-Bromo-3-(tetrahydro-2-pyranyloxy)pyridine is a chemical compound characterized by its unique structure, which includes a bromine atom and a tetrahydro-2-pyranyloxy group attached to a pyridine ring. This compound features a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential reactivity. The presence of the bromine atom introduces electrophilic characteristics, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The tetrahydro-2-pyranyloxy group enhances the compound's solubility and stability, allowing for diverse functionalization. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety precautions should be observed when handling 2-Bromo-3-(tetrahydro-2-pyranyloxy)pyridine, as it may pose health risks if not managed properly.
Formula:C10H12BrNO2
InChI:InChI=1/C10H12BrNO2/c11-10-8(4-3-6-12-10)14-9-5-1-2-7-13-9/h3-4,6,9H,1-2,5,7H2
SMILES:C1CCOC(C1)Oc1cccnc1Br
Synonyms:- 2-Bromo-3-Tetrahydropyran-2-Yloxy-Pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.