CAS 93565-01-6
:N,N'-di(buta-2,3-dien-1-yl)butane-1,4-diamine
Description:
N,N'-di(buta-2,3-dien-1-yl)butane-1,4-diamine, identified by its CAS number 93565-01-6, is an organic compound characterized by its structure, which includes two buta-2,3-dien-1-yl groups attached to a butane-1,4-diamine backbone. This compound features multiple double bonds due to the butadiene moieties, which can participate in various chemical reactions, including polymerization and cross-linking. It is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the butadiene units may also impart unique physical properties, such as increased reactivity and potential for forming conjugated systems. Additionally, due to its structure, it may be used in applications related to polymer chemistry, such as in the synthesis of elastomers or as a cross-linking agent in various materials. Safety and handling precautions should be observed, as with many amines and reactive organic compounds, due to potential toxicity and reactivity.
Formula:C11H18N2O4
InChI:InChI=1/C11H18N2O4/c1-11(2,3)17-9(14)12-4-5-13-8(6-12)7-16-10(13)15/h8H,4-7H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCN2C(C1)COC2=O
Synonyms:- 1,4-butanediamine, N~1~,N~4~-di-2,3-butadien-1-yl-
- N,N'-Di(buta-2,3-dien-1-yl)butane-1,4-diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N1,N4-Di(buta-2,3-dienyl)butane-1,4-diamine dihydrochloride
CAS:Formula:C12H22Cl2N2Purity:97%Color and Shape:SolidMolecular weight:265.2225MDL 72527
CAS:MDL 72527 (N1,N4-Di(buta-2,3-dien-1-yl)butane-1,4-diamine dihydrochloride) is a polyamine oxidase (POA) inhibitorFormula:C12H22Cl2N2Purity:98.98%Color and Shape:SolidMolecular weight:265.22Ref: TM-T22965
1mg38.00€2mg50.00€1mL*10mM (DMSO)82.00€5mg84.00€10mg119.00€25mg236.00€50mg385.00€100mg575.00€MDL 72527
CAS:Formula:C12H20N2·2HClPurity:≥ 95.0%Color and Shape:Off-white to pale pink solidMolecular weight:265.22N1,N4-Di(buta-2,3-dien-1-yl)butane-1,4-diamine dihydrochloride
CAS:Purity:95.0%Molecular weight:265.2200012207031N1,N4-Di(buta-2,3-dienyl)butane-1,4-diamine dihydrochloride
CAS:N1,N4-Di(buta-2,3-dienyl)butane-1,4-diamine is a natural compound that inhibits polyamine oxidase (PAO), an enzyme that catalyzes the oxidation of polyamines. PAO is involved in the development of cancer and neuronal death. N1,N4-Di(buta-2,3-dienyl)butane-1,4-diamine has been shown to inhibit PAO activity in human carcinoma cell lines and to be neuroprotective in a rat model of Parkinson's disease. This agent also induces apoptosis by depolarizing mitochondrial membrane potential. It has been shown to be more potent than protocatechuic acid and irreversible inhibition can occur when cells are exposed for long periods of time.Formula:C12H20N2•(HCl)2Purity:Min. 95%Color and Shape:SolidMolecular weight:265.22 g/mol






