CAS 935660-75-6

N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide

Description:

N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide, with the CAS number 935660-75-6, is an organic compound characterized by its unique structure that includes a benzamide moiety and a boron-containing dioxaborolane group. This compound typically exhibits properties associated with both aromatic and boron-containing compounds, such as potential stability under various conditions and the ability to participate in coordination chemistry. The presence of the dioxaborolane group suggests it may have applications in organic synthesis, particularly in cross-coupling reactions, due to the reactivity of boron in forming organoboron intermediates. Additionally, the tetramethyl substitution enhances its solubility and may influence its electronic properties, making it suitable for applications in materials science or medicinal chemistry. Overall, this compound's characteristics make it a valuable candidate for research in synthetic methodologies and functional materials.

Formula: C₁₉H₂₂BNO₃

InChI: InChI=1/C19H22BNO3/c1-18(2)19(3,4)24-20(23-18)15-10-12-16(13-11-15)21-17(22)14-8-6-5-7-9-14/h5-13H,1-4H3,(H,21,22)

SMILES: CC1(C)C(C)(C)OB(c2ccc(cc2)NC(=O)c2ccccc2)O1

N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide

CAS: 935660-75-6

Formula: C₁₉H₂₂BNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 323.1939

Ref: IN-DA00H2RU

N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide

CAS: 935660-75-6

N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide

Purity: 95%

Molecular weight: 323.201g/mol

Ref: 54-OR74187

N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide

CAS: 935660-75-6

Formula: C₁₉H₂₂BNO₃

Purity: 95%

Molecular weight: 323.2

Ref: 10-F225263