CymitQuimica logo

CAS 935666-88-9

:

AZD-1480

Description:
AZD-1480, with the CAS number 935666-88-9, is a small molecule inhibitor primarily known for its role in targeting Janus kinase (JAK) pathways, particularly JAK2. This compound has garnered attention in the field of pharmacology for its potential therapeutic applications, especially in the treatment of various inflammatory and autoimmune diseases, as well as certain types of cancer. AZD-1480 exhibits characteristics typical of kinase inhibitors, including the ability to modulate signaling pathways involved in cell proliferation and survival. Its mechanism of action involves the selective inhibition of JAK2, which plays a crucial role in the signaling of several cytokines and growth factors. In preclinical studies, AZD-1480 has demonstrated efficacy in reducing inflammation and tumor growth, making it a candidate for further clinical investigation. However, like many investigational drugs, its safety profile, pharmacokinetics, and long-term effects are subjects of ongoing research. Overall, AZD-1480 represents a promising avenue in targeted therapy, particularly in conditions driven by dysregulated JAK signaling.
Formula:C14H14ClFN8
InChI:InChI=1S/C14H14ClFN8/c1-7-3-11(24-23-7)21-13-10(15)6-19-14(22-13)20-8(2)12-17-4-9(16)5-18-12/h3-6,8H,1-2H3,(H3,19,20,21,22,23,24)/t8-/m0/s1
InChI key:PDOQBOJDRPLBQU-QMMMGPOBSA-N
SMILES:CC1=CC(=NN1)NC2=NC(=NC=C2Cl)N[C@@H](C)C3=NC=C(C=N3)F
Found 7 products.