CymitQuimica logo

CAS 935668-15-8

:

N-(azetidin-3-yl)-N-methylacetamide hydrochloride

Description:
N-(azetidin-3-yl)-N-methylacetamide hydrochloride is a chemical compound characterized by its unique structure, which includes an azetidine ring and an acetamide functional group. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it useful in pharmaceutical applications. The presence of the azetidine moiety suggests potential biological activity, as azetidine derivatives are often explored for their roles in medicinal chemistry. The hydrochloride salt form enhances its stability and solubility, which is advantageous for formulation in drug development. Its molecular structure allows for interactions with biological targets, potentially influencing pharmacological properties. As with many compounds, safety and handling precautions should be observed, as the specific toxicity and safety profile would depend on its use and concentration. Overall, N-(azetidin-3-yl)-N-methylacetamide hydrochloride represents a compound of interest in the field of organic and medicinal chemistry.
Formula:C6H13ClN2O
InChI:InChI=1S/C6H12N2O.ClH/c1-5(9)8(2)6-3-7-4-6;/h6-7H,3-4H2,1-2H3;1H
InChI key:CLRZDNKDFGOBEF-UHFFFAOYSA-N
SMILES:CC(=O)N(C)C1CNC1.Cl
Found 5 products.