CAS 93567-90-9
:4-butoxy-3-ethoxybenzaldehyde
Description:
4-Butoxy-3-ethoxybenzaldehyde, with the CAS number 93567-90-9, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features two alkoxy substituents: a butoxy group and an ethoxy group, which contribute to its solubility and reactivity. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of the aldehyde functional group, which can participate in various chemical reactions, including nucleophilic addition and oxidation. The presence of the butoxy and ethoxy groups can enhance the compound's hydrophobic characteristics, influencing its behavior in different solvents. Additionally, 4-butoxy-3-ethoxybenzaldehyde may exhibit interesting biological activities, making it of interest in fields such as medicinal chemistry and materials science. Its synthesis often involves the alkylation of phenolic compounds or the use of specific reagents to introduce the desired functional groups. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C13H18O3
InChI:InChI=1/C13H18O3/c1-3-5-8-16-12-7-6-11(10-14)9-13(12)15-4-2/h6-7,9-10H,3-5,8H2,1-2H3
SMILES:CCCCOc1ccc(cc1OCC)C=O
Synonyms:- Benzaldehyde, 4-butoxy-3-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.