CAS 93567-91-0
:3-Ethoxy-4-(2-methylpropoxy)benzaldehyde
Description:
3-Ethoxy-4-(2-methylpropoxy)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group. This compound contains an ethoxy group and a branched alkoxy substituent, specifically a 2-methylpropoxy group, which contributes to its unique chemical properties. The presence of these substituents influences its solubility, reactivity, and potential applications in organic synthesis and fragrance chemistry. Typically, compounds like this may exhibit moderate to high volatility and can be soluble in organic solvents while being less soluble in water due to their hydrophobic alkyl chains. The compound may also participate in various chemical reactions, such as nucleophilic additions or substitutions, due to the electrophilic nature of the aldehyde group. Its specific characteristics, such as boiling point, melting point, and density, would depend on the molecular interactions and the arrangement of its substituents. Overall, 3-Ethoxy-4-(2-methylpropoxy)benzaldehyde is of interest in the fields of synthetic organic chemistry and potentially in the development of fragrances or flavoring agents.
Formula:C13H18O3
InChI:InChI=1/C13H18O3/c1-4-15-13-7-11(8-14)5-6-12(13)16-9-10(2)3/h5-8,10H,4,9H2,1-3H3
InChI key:InChIKey=BVHHJYYHHQIPCB-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OCC(C)C)C=CC(C=O)=C1
Synonyms:- 3-Ethoxy-4-Isobutoxybenzaldehyde
- 3-Ethoxy-4-isobutoxy-benzaldehyde
- Benzaldehyde, 3-Ethoxy-4-(2-Methylpropoxy)-
- Benzaldehyde, 3-ethoxy-4-isobutoxy-
- 3-Ethoxy-4-(2-methylpropoxy)benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.