CAS 935680-90-3
:5-tert-butyl-2,3-dihydro-1H-inden-1-amine
Description:
5-tert-butyl-2,3-dihydro-1H-inden-1-amine is an organic compound characterized by its unique bicyclic structure, which includes an indene framework with a tert-butyl group and an amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the tert-butyl group contributes to steric hindrance, potentially affecting its reactivity and interactions with other molecules. Additionally, the bicyclic nature of the indene structure may impart specific electronic properties, making it of interest in various chemical applications, including pharmaceuticals and organic synthesis. The compound's stability and reactivity can be influenced by factors such as temperature and the presence of other functional groups. Overall, 5-tert-butyl-2,3-dihydro-1H-inden-1-amine represents a versatile structure within organic chemistry, with potential applications in medicinal chemistry and materials science.
Formula:C13H19N
InChI:InChI=1/C13H19N/c1-13(2,3)10-5-6-11-9(8-10)4-7-12(11)14/h5-6,8,12H,4,7,14H2,1-3H3
SMILES:CC(C)(C)c1ccc2c(CCC2N)c1
Synonyms:- 1H-inden-1-amine, 5-(1,1-dimethylethyl)-2,3-dihydro-
- 5-Tert-Butyl-1-Amino-Indan
- 5-tert-Butylindan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.