
CAS 935685-89-5
:1H-Pyrrolo[2,3-c]pyridine, hydrobromide (1:1)
Description:
1H-Pyrrolo[2,3-c]pyridine, hydrobromide (1:1) is a chemical compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. This compound is typically encountered as a hydrobromide salt, indicating that it is combined with hydrobromic acid, which enhances its solubility in polar solvents. The presence of nitrogen atoms in both rings contributes to its basicity and potential reactivity, making it of interest in various chemical applications, including medicinal chemistry and organic synthesis. The compound may exhibit biological activity, which can be explored for potential pharmaceutical applications. Its CAS number, 935685-89-5, allows for easy identification and retrieval of information in chemical databases. As with many nitrogen-containing heterocycles, it may participate in diverse chemical reactions, including electrophilic substitutions and nucleophilic attacks, depending on the functional groups present. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C7H6N2·BrH
InChI:InChI=1S/C7H6N2.BrH/c1-3-8-5-7-6(1)2-4-9-7;/h1-5,9H;1H
InChI key:InChIKey=OAAJMPOMZDDCCN-UHFFFAOYSA-N
SMILES:C1=2C(NC=C1)=CN=CC2.Br
Synonyms:- 1H-Pyrrolo[2,3-c]pyridine, hydrobromide (1:1)
- 1H-Pyrrolo[2,3-c]pyridine hydrobromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
