CAS 935841-15-9

1-[(4-Bromo-2-chlorophenyl)methyl]pyrrolidine

Description:

1-[(4-Bromo-2-chlorophenyl)methyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a substituted phenyl group. The presence of bromine and chlorine atoms on the phenyl ring contributes to its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents, and its molecular structure suggests it may engage in various interactions, including hydrogen bonding and π-π stacking due to the aromatic system. The pyrrolidine moiety can influence the compound's pharmacological properties, making it of interest in medicinal chemistry. Additionally, the halogen substituents may enhance lipophilicity and affect the compound's binding affinity to biological targets. As with many organic compounds, safety and handling precautions are essential, as halogenated compounds can pose environmental and health risks. Overall, 1-[(4-Bromo-2-chlorophenyl)methyl]pyrrolidine represents a class of compounds that may have applications in drug development and chemical research.

Formula: C₁₁H₁₃BrClN

InChI: InChI=1S/C11H13BrClN/c12-10-4-3-9(11(13)7-10)8-14-5-1-2-6-14/h3-4,7H,1-2,5-6,8H2

InChI key: InChIKey=BNIJHZLSHWWWCJ-UHFFFAOYSA-N

SMILES: C(C1=C(Cl)C=C(Br)C=C1)N2CCCC2

Synonyms:

• 1-[(4-Bromo-2-chlorophenyl)methyl]pyrrolidine
• Pyrrolidine, 1-[(4-bromo-2-chlorophenyl)methyl]-
• 1-(4-Bromo-2-chlorobenzyl)pyrrolidine