CAS 935850-03-6
:5,6-dihydro-1,3-benzothiazol-7(4H)-one
Description:
5,6-Dihydro-1,3-benzothiazol-7(4H)-one is a heterocyclic compound characterized by its benzothiazole structure, which consists of a fused benzene and thiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocycles. It may display biological activity, potentially serving as a scaffold for pharmaceutical development due to its unique structural features. The presence of the carbonyl group in the thiazole ring can contribute to its reactivity, making it a candidate for various chemical transformations. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical applications. Its stability and reactivity can be influenced by substituents on the rings, and it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C7H7NOS
InChI:InChI=1/C7H7NOS/c9-6-3-1-2-5-7(6)10-4-8-5/h4H,1-3H2
SMILES:C1Cc2c(C(=O)C1)scn2
Synonyms:- 7(4H)-Benzothiazolone, 5,6-dihydro-
- 5,6-Dihydrobenzo[D]Thiazol-7(4H)-One
- 5,6-Dihydro-1,3-benzothiazol-7(4H)-one
- 5,6-Dihydrobenzothiazol-7(4H)-one
- 5,6-dihydro-4H-1,3-benzothiazol-7-one
- 5,6-Dihydrobenzo[d]thiazol-7(4H)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7(4H)-Benzothiazolone, 5,6-dihydro-
CAS:Formula:C7H7NOSPurity:98%Color and Shape:SolidMolecular weight:153.20165,6-Dihydrobenzo[d]thiazol-7(4H)-one
CAS:5,6-Dihydrobenzo[d]thiazol-7(4H)-onePurity:98%Molecular weight:153.206g/mol5,6-Dihydrobenzo[d]thiazol-7(4H)-one
CAS:5,6-Dihydrobenzo[d]thiazol-7(4H)-one is a chloride channel inhibitor that blocks the voltage-gated chloride channels (VGCCs) in the central and peripheral nervous system. It has been shown to be active against a number of oncological, cardiovascular, and autoimmune diseases. 5,6-Dihydrobenzo[d]thiazol-7(4H)-one inhibits nitric oxide synthase and nitrite production by reacting with the catalytic cysteine residue. The drug also inhibits nociceptive signaling in the spinal cord. Finally, 5,6-Dihydrobenzo[d]thiazol-7(4H)-one is an amine analogue that can inhibit kinases such as protein kinase C (PKC) or tyrosine kinases.
Formula:C7H7NOSPurity:Min. 95%Molecular weight:153.2 g/mol



