CAS 93589-69-6
:4,4′-[Methylenebis(oxy-2,1-ethanediylthio)]bis[phenol]
Description:
4,4′-[Methylenebis(oxy-2,1-ethanediylthio)]bis[phenol], with CAS number 93589-69-6, is an organic compound characterized by its structure, which includes two phenolic groups linked by a methylene bridge and thioether functionalities. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in polymer chemistry, particularly as a crosslinking agent or antioxidant in various materials. It is soluble in organic solvents, and its chemical stability can be influenced by environmental factors such as temperature and pH. The presence of multiple functional groups allows for reactivity in various chemical processes, making it useful in the synthesis of more complex molecules. Safety data should be consulted for handling, as phenolic compounds can be hazardous. Overall, this compound is of interest in both industrial applications and research settings due to its unique structural features and potential utility in material science.
Formula:C17H20O4S2
InChI:InChI=1S/C17H20O4S2/c18-14-1-5-16(6-2-14)22-11-9-20-13-21-10-12-23-17-7-3-15(19)4-8-17/h1-8,18-19H,9-13H2
InChI key:InChIKey=QBZPUSKHVURBGP-UHFFFAOYSA-N
SMILES:S(CCOCOCCSC1=CC=C(O)C=C1)C2=CC=C(O)C=C2
Synonyms:- 1,7-Bis(4-hydroxyphenylthio)-3,5-dioxaheptane
- 4,4'-[Methanediylbis(Oxyethane-2,1-Diylsulfanediyl)]Diphenol
- 4,4′-[Methylenebis(oxy-2,1-ethanediylthio)]bis[phenol]
- Bis[2-(4-hydroxyphenylthio)ethoxy]methane
- Phenol, 4,4'-(methylenebis(oxy-2,1-ethanediylthio))bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bis[2-(4-hydroxyphenylthio)ethoxy]methane
CAS:Controlled Product<p>Applications Bis[2-(4-hydroxyphenylthio)ethoxy]methane is a colour developer of the leuco-type thermosensitive papers.<br>References Taniguchi, K., Furuya, H.: Denshi Shashin Gakkaishi, 32, 18 (1993)<br></p>Formula:C17H20O4S2Color and Shape:Off-WhiteMolecular weight:352.47
