CAS 936-16-3
:2,3-dihydro-1,2-benzothiazole 1,1-dioxide
Description:
2,3-Dihydro-1,2-benzothiazole 1,1-dioxide, also known by its CAS number 936-16-3, is a heterocyclic compound characterized by a benzothiazole ring structure that incorporates a sulfur atom and a nitrogen atom within a fused ring system. This compound features a dihydro form, indicating the presence of two hydrogen atoms that contribute to its saturation. The 1,1-dioxide designation signifies the presence of two double-bonded oxygen atoms attached to the sulfur atom, enhancing its reactivity and solubility in polar solvents. Typically, this compound exhibits properties such as moderate stability under standard conditions, and it may participate in various chemical reactions, including oxidation and nucleophilic substitution. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, depending on its specific reactivity and functionalization. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H7NO2S
InChI:InChI=1/C7H7NO2S/c9-11(10)7-4-2-1-3-6(7)5-8-11/h1-4,8H,5H2
SMILES:c1ccc2c(c1)CNS2(=O)=O
Synonyms:- 1,2-Benzisothiazole, 2,3-dihydro-, 1,1-dioxide
- 1,2-Benzoisothiazoline 1,1-dioxide
- 2,3-Dihydro-1,1-dioxo-1,2-benzisothiazole
- 2,3-Dihydro-1,2-Benzisothiazole-1,1-Dioxide
- 2,3-Dihydrobenz(d)isothiazole 1,1-dioxide
- 2,3-Dihydro-benzo[d]isothiazole 1,1-dioxide
- 936-16-3
- 2,3-Dihydro-1,2-benzothiazole 1,1-dioxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-DIHYDRO-1,1-DIOXO-1,2-BENZISOTHIAZOLE
CAS:Formula:C7H7NO2SPurity:95%Color and Shape:SolidMolecular weight:169.20102,3-Dihydro-1,1-dioxo-1,2-benzisothiazole
CAS:2,3-Dihydro-1,1-dioxo-1,2-benzisothiazoleFormula:C7H7NO2SPurity:96%Color and Shape: white solidMolecular weight:169.20g/mol2,3-Dihydrobenzo[d]isothiazole 1,1-dioxide
CAS:Formula:C7H7NO2SPurity:95%Color and Shape:SolidMolecular weight:169.22,3-dihydro-1lambda6,2-benzothiazole-1,1-dione
CAS:2,3-Dihydro-1lambda6,2-benzothiazole-1,1-dione is a plant growth regulator that is used in horticultural applications. It is an anion that can be used as an additive to prevent corrosion and rusting of metals. 2,3-Dihydro-1lambda6,2-benzothiazole-1,1-dione reacts with chloride ions to form the corresponding chromatographic product. This compound also forms reaction products with other compounds such as pyrrole, amide and carbonyl group.
Formula:C7H7NO2SPurity:Min. 95%Molecular weight:169.2 g/mol



