CAS 936-18-5
:(4aR,8aS)-Octahydro-1(2H)-naphthalenone
Description:
(4aR,8aS)-Octahydro-1(2H)-naphthalenone, with CAS number 936-18-5, is a bicyclic organic compound characterized by its unique fused ring structure. This substance belongs to the class of ketones, specifically a saturated bicyclic ketone, which contributes to its chemical stability and reactivity. The compound features a specific stereochemistry, indicated by the (4aR,8aS) designation, which refers to the spatial arrangement of its atoms and affects its physical and chemical properties. Typically, such compounds exhibit moderate polarity due to the presence of the carbonyl group, influencing their solubility in various solvents. In terms of applications, (4aR,8aS)-Octahydro-1(2H)-naphthalenone may serve as an intermediate in organic synthesis or as a building block in the development of pharmaceuticals and fragrances. Its structural characteristics also suggest potential interactions with biological systems, making it of interest in medicinal chemistry. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research and application.
Formula:C10H16O
InChI:InChI=1S/C10H16O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h8-9H,1-7H2/t8-,9+/m1/s1
InChI key:InChIKey=AFEFRXAPJRCTOW-BDAKNGLRSA-N
SMILES:O=C1[C@@]2([C@@](CCC1)(CCCC2)[H])[H]
Synonyms:- 1(2H)-Naphthalenone, octahydro-, (4aR-trans)-
- (4aR,8aS)-Octahydro-1(2H)-naphthalenone
- 1(2H)-Naphthalenone, octahydro-, (4aR,8aS)-
- (9S)-trans-1-Decalone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
