CAS 936-26-5
:(1-chloro-2-methylpropyl)benzene
Description:
(1-Chloro-2-methylpropyl)benzene, also known as benzyl 1-chloro-2-methylpropyl, is an organic compound characterized by a benzene ring substituted with a 1-chloro-2-methylpropyl group. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is classified as an alkyl halide due to the presence of the chlorine atom, which contributes to its reactivity. The compound is moderately soluble in organic solvents but has limited solubility in water, reflecting its hydrophobic nature. Its chemical structure allows for various reactions, including nucleophilic substitution and elimination reactions, making it useful in organic synthesis. Additionally, (1-chloro-2-methylpropyl)benzene may exhibit properties such as volatility and flammability, necessitating careful handling and storage. Safety data sheets should be consulted for specific hazards and handling precautions. Overall, this compound serves as an important intermediate in the synthesis of more complex organic molecules in the field of chemistry.
Formula:C10H13Cl
InChI:InChI=1/C10H13Cl/c1-8(2)10(11)9-6-4-3-5-7-9/h3-8,10H,1-2H3
SMILES:CC(C)C(c1ccccc1)Cl
Synonyms:- Benzene, (1-Chloro-2-Methylpropyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(1-Chloro-2-methylpropyl)benzene
CAS:1-Chloro-2-methylpropylbenzene is a medicine that has been used in the treatment of cancer. It is an alkylating agent and a chloride channel blocker. It interferes with the production of proteins by disrupting DNA and RNA synthesis, leading to cancer cell death. The reaction time for 1-chloro-2-methylpropylbenzene is constant at pH 7.4 and 37°C, due to its high reactivity. This alkylating agent also inhibits the activity of hydroxylase enzymes in fungi and nitroreductase enzymes in bacteria, which are responsible for the synthesis of nitric oxide (NO).Formula:C10H13ClPurity:Min. 95%Molecular weight:168.66 g/mol
