CAS 936-58-3
:4-Phenyl-1-buten-4-ol
Description:
4-Phenyl-1-buten-4-ol, with the CAS number 936-58-3, is an organic compound characterized by its unique structure, which includes a phenyl group attached to a butenol moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its aromatic properties due to the presence of the phenyl group. It features a double bond in the butenol part of its structure, which contributes to its reactivity and potential applications in organic synthesis. The hydroxyl (-OH) group in 4-Phenyl-1-buten-4-ol makes it an alcohol, allowing it to participate in various chemical reactions, such as dehydration and esterification. This compound is of interest in the fields of organic chemistry and materials science, particularly for its potential use in the synthesis of more complex molecules. Additionally, its physical properties, such as boiling point and solubility, can vary based on environmental conditions and purity. Safety precautions should be taken when handling this compound, as with many organic chemicals.
Formula:C10H12O
InChI:InChI=1/C10H12O/c1-2-6-10(11)9-7-4-3-5-8-9/h2-5,7-8,10-11H,1,6H2/t10-/m1/s1
SMILES:C=CC[C@H](c1ccccc1)O
Synonyms:- (1S)-1-phenylbut-3-en-1-ol
- (1R)-1-phenylbut-3-en-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Phenyl-3-buten-1-ol
CAS:Formula:C10H12OPurity:>97.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:148.214-Phenyl-1-buten-4-ol, 97%
CAS:4-Phenyl-1-buten-4-ol is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference h
Formula:C10H12OPurity:97%Color and Shape:Colorless to pale yellow, LiquidMolecular weight:148.211-Phenyl-3-buten-1-ol
CAS:Formula:C10H12OPurity:97% (stabilized with MEHQ)Color and Shape:LiquidMolecular weight:148.2051-Phenyl-3-buten-1-ol
CAS:1-Phenyl-3-buten-1-ol is an organometallic compound that is synthesized by the reaction of zinc powder and allyl bromide in a hydrochloric acid solution. This reaction system is acidic, which can be controlled using a base. The reaction mechanism for this process has been studied using functional theory and was found to be a concerted type of radical addition. The immobilization of 1-phenyl-3-buten-1-ol on mesoporous silica particles enhances its photocatalytic activity.Formula:C10H12OPurity:Min. 95%Molecular weight:148.21 g/mol





