CAS 936-83-4
:3-(2-oxotetrahydrofuran-3-yl)propanoic acid
Description:
3-(2-Oxotetrahydrofuran-3-yl)propanoic acid, with the CAS number 936-83-4, is an organic compound characterized by its unique structure that includes a propanoic acid moiety and a tetrahydrofuran ring. This compound features a carbonyl group adjacent to the tetrahydrofuran, contributing to its reactivity and potential applications in organic synthesis. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. The compound may exhibit acidic properties due to the carboxylic acid, which can participate in various chemical reactions, including esterification and amidation. Its structural features suggest potential uses in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the presence of the tetrahydrofuran ring may impart specific stereochemical properties, influencing its biological activity and interactions with other molecules. Overall, 3-(2-oxotetrahydrofuran-3-yl)propanoic acid is a versatile compound with significant implications in chemical research and application.
Formula:C7H10O4
InChI:InChI=1/C7H10O4/c8-6(9)2-1-5-3-4-11-7(5)10/h5H,1-4H2,(H,8,9)
SMILES:C(CC(=O)O)C1CCOC1=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.