CAS 936-87-8

Formula: C7H10O4

InChI: InChI=1S/C7H10O4/c1-7(2)3(5(8)9)4(7)6(10)11/h3-4H,1-2H3,(H,8,9)(H,10,11)/t3-,4+

InChI key: MSPJNHHBNOLHOC-ZXZARUISSA-N

SMILES: CC1([C@H]([C@H]1C(=O)O)C(=O)O)C

Cis-Caronic Acid

CAS: 936-87-8

Formula: C₇H₁₀O₄

Molecular weight: 158.15

Ref: 4Z-C-411002

(1R,2S)-3,3-Dimethylcyclopropane-1,2-dicarboxylic acid

CAS: 936-87-8

(1R,2S)-3,3-Dimethylcyclopropane-1,2-dicarboxylic acid is an oxidation product of 1,2-cyclohexanedione. It is a colorless crystalline solid that can be extracted from the oxidation of cyclopentanone with permanganate. The oxidizing properties of (1R,2S)-3,3-dimethylcyclopropane-1,2-dicarboxylic acid are due to its ability to react with hydrogen peroxide and water to form hydroxyacetic acid. This compound has been used in the synthesis of other chemicals and pharmaceuticals.

Formula: C₇H₁₀O₄

Purity: Min. 95%

Molecular weight: 158.15 g/mol

Ref: 3D-AAA93687