CAS 93600-66-9

4,8-Dichloro-2-trichloromethylquinoline

Description:

4,8-Dichloro-2-trichloromethylquinoline, identified by its CAS number 93600-66-9, is a synthetic organic compound belonging to the quinoline family, characterized by a bicyclic structure containing a nitrogen atom. This compound features multiple chlorine substituents, specifically at the 4 and 8 positions of the quinoline ring, and a trichloromethyl group at the 2 position. The presence of these chlorine atoms significantly influences its chemical properties, including its reactivity and potential biological activity. Typically, compounds with such halogenated structures exhibit lipophilicity, which can affect their solubility in organic solvents and their behavior in biological systems. 4,8-Dichloro-2-trichloromethylquinoline may be of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications as a pharmaceutical agent or pesticide. However, the specific toxicity, environmental impact, and regulatory status of this compound would require further investigation to ensure safe handling and usage.

Formula: C₁₀H₄Cl₅N

InChI: InChI=1/C10H4Cl5N/c11-6-3-1-2-5-7(12)4-8(10(13,14)15)16-9(5)6/h1-4H

SMILES: c1cc2c(cc(C(Cl)(Cl)Cl)nc2c(c1)Cl)Cl

4,8-Dichloro-2-trichloromethylquinoline

CAS: 93600-66-9

4,8-Dichloro-2-trichloromethylquinoline

Purity: ≥95%

Molecular weight: 315.41g/mol

Ref: 54-OR309242