CymitQuimica logo

CAS 936011-17-5

:

4-pyridinecarboxaldehyde, 5-bromo-2-methoxy-

Description:
4-Pyridinecarboxaldehyde, 5-bromo-2-methoxy- is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxaldehyde functional group (-CHO) at the 4-position of the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of a bromine atom at the 5-position introduces a halogen, which can influence the compound's reactivity and physical properties, such as solubility and boiling point. Additionally, the methoxy group (-OCH3) at the 2-position enhances the compound's electron-donating characteristics, affecting its overall reactivity and interaction with other chemical species. This compound may be utilized in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features. Its specific properties, such as melting point, boiling point, and solubility, would need to be referenced from experimental data or literature for precise applications.
Formula:C7H6BrNO2
InChI:InChI=1/C7H6BrNO2/c1-11-7-2-5(4-10)6(8)3-9-7/h2-4H,1H3
InChI key:GSHIHNCXBSQCLM-UHFFFAOYSA-N
SMILES:COc1cc(C=O)c(cn1)Br
Synonyms:
  • 5-Bromo-2-methoxyisonicotinaldehyde
Found 5 products.