
CAS 936011-18-6
:5-Ethenyl-2-methoxy-4-pyridinecarboxaldehyde
Description:
5-Ethenyl-2-methoxy-4-pyridinecarboxaldehyde, identified by its CAS number 936011-18-6, is an organic compound featuring a pyridine ring substituted with both an ethenyl group and a methoxy group, as well as an aldehyde functional group. This compound is characterized by its aromatic nature due to the presence of the pyridine ring, which contributes to its chemical reactivity and potential applications in organic synthesis. The ethenyl group introduces a double bond, enhancing its reactivity, while the methoxy group can influence its solubility and polarity. The aldehyde functional group is known for its reactivity in various chemical reactions, including condensation and oxidation processes. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in the synthesis of more complex molecules, and it may serve as an intermediate in the production of pharmaceuticals or agrochemicals. As with many organic compounds, its properties such as boiling point, melting point, and solubility would depend on the specific conditions and purity of the substance.
Formula:C9H9NO2
InChI:InChI=1S/C9H9NO2/c1-3-7-5-10-9(12-2)4-8(7)6-11/h3-6H,1H2,2H3
InChI key:InChIKey=DLEHPSLUAGRKKJ-UHFFFAOYSA-N
SMILES:C(=O)C=1C(C=C)=CN=C(OC)C1
Synonyms:- 4-Pyridinecarboxaldehyde, 5-ethenyl-2-methoxy-
- 2-Methoxy-5-vinylisonicotinaldehyde
- 5-Ethenyl-2-methoxy-4-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.