CAS 936074-36-1
:ethyl 6-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate
Description:
Ethyl 6-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features a chlorine atom at the 6-position of the pyrazolo ring, contributing to its reactivity and potential biological activity. The ethyl ester functional group at the 3-position enhances its solubility and may influence its pharmacokinetic properties. Typically, compounds of this class are investigated for their potential applications in medicinal chemistry, particularly as inhibitors or modulators in various biological pathways. The presence of the carboxylate group suggests potential for further derivatization, which can be useful in drug design. Additionally, the compound's molecular structure may exhibit specific interactions with biological targets, making it of interest in the development of therapeutic agents. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H8ClN3O2
InChI:InChI=1/C9H8ClN3O2/c1-2-15-9(14)7-4-12-13-5-6(10)3-11-8(7)13/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1cnn2cc(cnc12)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ethyl 6-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate
CAS:Formula:C9H8ClN3O2Molecular weight:225.6317
