CymitQuimica logo

CAS 936074-38-3

:

2,4-dimethylquinoline-7-carboxylic acid

Description:
2,4-Dimethylquinoline-7-carboxylic acid is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a nitrogen atom. This compound features two methyl groups at the 2 and 4 positions of the quinoline ring and a carboxylic acid functional group at the 7 position, which contributes to its acidic properties. The presence of the carboxylic acid group enhances its solubility in polar solvents and allows for potential interactions in various chemical reactions, such as esterification or amidation. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and material science. Additionally, the compound's unique arrangement of functional groups may influence its reactivity and stability under different conditions. As with many quinoline derivatives, it may also display fluorescence, which can be useful in analytical applications. Overall, 2,4-dimethylquinoline-7-carboxylic acid is a versatile compound with potential implications in various fields of chemistry and biochemistry.
Formula:C12H11NO2
InChI:InChI=1/C12H11NO2/c1-7-5-8(2)13-11-6-9(12(14)15)3-4-10(7)11/h3-6H,1-2H3,(H,14,15)
SMILES:Cc1cc(C)nc2cc(ccc12)C(=O)O
Synonyms:
  • 7-Quinolinecarboxylic Acid, 2,4-Dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.