CAS 936074-51-0

1-(5-Chloro-2-benzoxazolyl)-4-piperidinecarboxylic acid

Description:

1-(5-Chloro-2-benzoxazolyl)-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and a piperidine moiety. The presence of the chloro substituent on the benzoxazole ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic acid due to the carboxylic acid functional group (-COOH) attached to the piperidine ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit significant biological properties, including antimicrobial or anti-inflammatory activities. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its synthesis may involve various organic reactions, including coupling reactions and functional group transformations. Overall, 1-(5-Chloro-2-benzoxazolyl)-4-piperidinecarboxylic acid represents a class of compounds that are of interest for further research in drug development and chemical synthesis.

Formula: C₁₃H₁₃ClN₂O₃

InChI: InChI=1/C13H13ClN2O3/c14-9-1-2-11-10(7-9)15-13(19-11)16-5-3-8(4-6-16)12(17)18/h1-2,7-8H,3-6H2,(H,17,18)

SMILES: c1cc2c(cc1Cl)nc(N1CCC(CC1)C(=O)O)o2

Synonyms:

• 1-(5-Chlorobenzo[d]oxazol-2-yl)piperidine-4-carboxylic acid
• 1-(5-Chloro-1,3-Benzoxazol-2-Yl)Piperidine-4-Carboxylic Acid

1-(5-Chlorobenzo[d]oxazol-2-yl)piperidine-4-carboxylic acid

CAS: 936074-51-0

Formula: C₁₃H₁₃ClN₂O₃

Molecular weight: 280.7069

Ref: IN-DA00GTM7

1-(5-CHLOROBENZO[D]OXAZOL-2-YL)PIPERIDINE-4-CARBOXYLIC ACID

CAS: 936074-51-0

Formula: C₁₃H₁₃ClN₂O₃

Purity: 95.0%

Molecular weight: 280.71

Ref: 10-F386455