CymitQuimica logo

CAS 936074-52-1

:

6-Chloro-2-(3-piperidinylmethyl)-1H-benzimidazole

Description:
6-Chloro-2-(3-piperidinylmethyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a chlorine atom and a piperidinylmethyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the piperidine moiety, which is known for its role in various pharmacological applications. The chlorine substituent can influence the compound's lipophilicity and reactivity, potentially affecting its interaction with biological targets. In terms of solubility, compounds of this nature may exhibit moderate solubility in organic solvents, while their solubility in water can vary based on the specific functional groups present. The compound's molecular structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. As with many chemical substances, safety and handling precautions are essential, given the potential for biological activity and the presence of chlorine, which can be hazardous in certain contexts.
Formula:C13H16ClN3
InChI:InChI=1S/C13H16ClN3/c14-10-3-4-11-12(7-10)17-13(16-11)6-9-2-1-5-15-8-9/h3-4,7,9,15H,1-2,5-6,8H2,(H,16,17)
InChI key:InChIKey=MMOIJSZYUPRGBN-UHFFFAOYSA-N
SMILES:C(C=1NC=2C(N1)=CC(Cl)=CC2)C3CCCNC3
Synonyms:
  • 6-Chloro-2-(3-piperidinylmethyl)-1H-benzimidazole
  • 1H-Benzimidazole, 6-chloro-2-(3-piperidinylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.