CymitQuimica logo

CAS 936074-56-5

:

2-methoxy-5-(1,2,4-triazol-4-yl)aniline

Description:
2-Methoxy-5-(1,2,4-triazol-4-yl)aniline is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring. The presence of a methoxy group (-OCH3) at the 2-position and a 1,2,4-triazole moiety at the 5-position contributes to its unique chemical properties. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the methoxy and amino groups, which can engage in hydrogen bonding. The triazole ring may impart additional biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal or antimicrobial agents. The compound's molecular structure suggests potential for various chemical reactions, including substitution and coupling reactions, which could be exploited in synthetic chemistry. Additionally, its stability under standard laboratory conditions is typical for similar organic compounds, although specific handling and storage conditions should be observed to maintain its integrity.
Formula:C9H10N4O
InChI:InChI=1/C9H10N4O/c1-14-9-3-2-7(4-8(9)10)13-5-11-12-6-13/h2-6H,10H2,1H3
SMILES:COc1ccc(cc1N)n1cnnc1
Synonyms:
  • benzenamine, 2-methoxy-5-(4H-1,2,4-triazol-4-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.