CAS 936074-68-9
:Carbamic acid, N-(6-amino-1,3-benzodioxol-5-yl)-, ethyl ester
Description:
Carbamic acid, N-(6-amino-1,3-benzodioxol-5-yl)-, ethyl ester, identified by CAS number 936074-68-9, is a chemical compound that features a carbamate functional group. This compound is characterized by the presence of an ethyl ester moiety linked to a benzodioxole structure, which contributes to its unique properties. The benzodioxole ring system is known for its potential biological activity, often associated with various pharmacological effects. The amino group in the structure may enhance its reactivity and solubility in polar solvents. Typically, carbamic acids and their esters are involved in various chemical reactions, including hydrolysis and transesterification. This compound may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. However, specific details regarding its stability, solubility, and reactivity would require further empirical investigation. Safety data and handling precautions should also be considered when working with this compound in a laboratory setting.
Formula:C10H12N2O4
InChI:InChI=1S/C10H12N2O4/c1-2-14-10(13)12-7-4-9-8(3-6(7)11)15-5-16-9/h3-4H,2,5,11H2,1H3,(H,12,13)
InChI key:InChIKey=IRKFKSOYYOSKEA-UHFFFAOYSA-N
SMILES:N(C(OCC)=O)C=1C=C2C(=CC1N)OCO2
Synonyms:- Carbamic acid, N-(6-amino-1,3-benzodioxol-5-yl)-, ethyl ester
- Ethyl N-(6-amino-1,3-benzodioxol-5-yl)carbamate
- Ethyl N-(6-amino-2H-1,3-benzodioxol-5-yl)carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.