CAS 936074-87-2

2-([1,2,4]triazolo[4,3-d][1,3,4]thiadiazol-6-yl)aniline

Description:

2-([1,2,4]triazolo[4,3-d][1,3,4]thiadiazol-6-yl)aniline is a chemical compound characterized by its complex heterocyclic structure, which includes both triazole and thiadiazole rings. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the aniline moiety suggests that it may participate in hydrogen bonding and other interactions, influencing its reactivity and potential applications. The compound's unique structure may also confer specific electronic properties, which can be relevant in the development of materials or as a lead compound in drug discovery. Additionally, its CAS number, 936074-87-2, allows for easy identification and retrieval of information related to its synthesis, safety data, and potential uses in various fields, including medicinal chemistry and materials science. Overall, this compound represents a fascinating area of study due to its structural complexity and potential applications.

Formula: C₉H₇N₅S

InChI: InChI=1/C9H7N5S/c10-7-4-2-1-3-6(7)8-13-14-5-11-12-9(14)15-8/h1-5H,10H2

SMILES: c1ccc(c(c1)c1nn2cnnc2s1)N