
CAS 936091-08-6
:N-(6-Methyl-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide
Description:
N-(6-Methyl-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide, with the CAS number 936091-08-6, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a boron-containing moiety. The presence of the dioxaborolane group suggests potential applications in medicinal chemistry, particularly in drug design and development, due to its ability to form stable complexes with various biological targets. The compound features a carboxamide functional group, which can enhance solubility and bioavailability. Additionally, the methyl substitution on the pyridine ring may influence its electronic properties and reactivity. This compound is likely to exhibit specific interactions with biological systems, making it of interest for research in pharmacology and biochemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and chromatography.
Formula:C18H22BN3O3
InChI:InChI=1S/C18H22BN3O3/c1-12-7-6-8-15(21-12)22-16(23)14-10-9-13(11-20-14)19-24-17(2,3)18(4,5)25-19/h6-11H,1-5H3,(H,21,22,23)
InChI key:InChIKey=VYSPNIXTVWMWJD-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=CC(C(NC=3N=C(C)C=CC3)=O)=NC2
Synonyms:- N-(6-Methyl-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide
- 2-Pyridinecarboxamide, N-(6-methyl-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-((6-Methylpyridin-2-yl)carbamoyl)pyridine-3-boronic acid pinacol ester
CAS:Formula:C18H22BN3O3Molecular weight:339.1966
