CAS 936098-39-4
:Methyl 4-chloro-2-iodobenzeneacetate
Description:
Methyl 4-chloro-2-iodobenzeneacetate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both chlorine and iodine atoms, as well as an ester functional group. The presence of the chlorine and iodine substituents contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical reactions, particularly in the synthesis of more complex molecules. The compound may exhibit moderate toxicity, and appropriate safety measures should be taken when handling it. Its unique combination of halogen substituents can influence its physical and chemical properties, such as boiling point, melting point, and reactivity, making it a valuable intermediate in pharmaceutical and agrochemical research. As with all chemical substances, proper storage and disposal practices are essential to ensure safety and environmental protection.
Formula:C9H8ClIO2
InChI:InChI=1S/C9H8ClIO2/c1-13-9(12)4-6-2-3-7(10)5-8(6)11/h2-3,5H,4H2,1H3
InChI key:InChIKey=YGSOBJJPAHOBDR-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1=C(I)C=C(Cl)C=C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-2-iodobenzeneacetic Acid Methyl Ester
CAS:Controlled ProductApplications 4-Chloro-2-iodobenzeneacetic Acid Methyl Ester is an intermediate in the synthesis of aldosterone synthase inhibitors.
References Rostovskii, N., et al.: Org. Lett., 4148 (2015);Formula:C9H8ClIO2Color and Shape:NeatMolecular weight:310.52
