CymitQuimica logo

CAS 936107-36-7

:

2-Bromo-3-(piperidin-1-ylmethyl)pyridine

Description:
2-Bromo-3-(piperidin-1-ylmethyl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a bromine atom and at the 3-position with a piperidin-1-ylmethyl group. This structure imparts unique properties, including potential biological activity, making it of interest in medicinal chemistry. The presence of the bromine atom enhances the compound's reactivity and can influence its interaction with biological targets. The piperidine moiety contributes to the compound's lipophilicity and may facilitate its ability to cross biological membranes. This compound is typically synthesized through specific organic reactions, and its properties can be further explored through various analytical techniques such as NMR, mass spectrometry, and chromatography. Additionally, its solubility, stability, and reactivity can vary depending on the solvent and conditions used. Overall, 2-Bromo-3-(piperidin-1-ylmethyl)pyridine represents a versatile scaffold for the development of pharmacologically active agents.
Formula:C11H15BrN2
InChI:InChI=1/C11H15BrN2/c12-11-10(5-4-6-13-11)9-14-7-2-1-3-8-14/h4-6H,1-3,7-9H2
Synonyms:
  • Pyridine, 2-bromo-3-(1-piperidinylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.