
CAS 936128-70-0
:5-Methyl-6-nitro-1H-indole
Description:
5-Methyl-6-nitro-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methyl group at the 5-position and a nitro group at the 6-position contributes to its unique chemical properties. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, reflecting its aromatic nature. The nitro group is known for its electron-withdrawing properties, which can influence the reactivity of the indole ring, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, 5-Methyl-6-nitro-1H-indole may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular formula and structure suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. As with many nitro compounds, care should be taken regarding its handling and storage due to potential toxicity and environmental concerns.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-6-4-7-2-3-10-8(7)5-9(6)11(12)13/h2-5,10H,1H3
InChI key:InChIKey=FKTZDJUZUCWNDS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(=CC1C)C=CN2
Synonyms:- 1H-Indole, 5-methyl-6-nitro-
- 5-Methyl-6-nitro-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.