CAS 93616-27-4
:Teicoplanin A 3-1
Description:
Teicoplanin A3-1 is a glycopeptide antibiotic derived from the fermentation of the bacterium *Amycolatopsis orientalis*. It is primarily used in clinical settings for the treatment of serious infections caused by Gram-positive bacteria, particularly those resistant to other antibiotics, such as methicillin-resistant *Staphylococcus aureus* (MRSA). The compound exhibits a mechanism of action that involves inhibiting bacterial cell wall synthesis by binding to the D-alanyl-D-alanine terminus of peptidoglycan precursors, thereby disrupting cell wall integrity and leading to cell lysis. Teicoplanin A3-1 is characterized by its complex structure, which includes multiple sugar moieties and a lipid tail that contribute to its antibacterial activity and pharmacokinetic properties. It is typically administered intravenously or intramuscularly and has a relatively long half-life, allowing for less frequent dosing. The substance is generally well-tolerated, though potential side effects may include allergic reactions and nephrotoxicity. Its use is often guided by susceptibility testing to ensure effectiveness against specific pathogens.
Formula:C72H68Cl2N8O28
InChI:InChI=1S/C72H68Cl2N8O28/c1-24(85)76-55-60(93)58(91)47(22-83)108-71(55)110-63-28-5-9-42(37(74)15-28)106-46-18-30-17-45(57(46)90)105-41-8-2-25(10-36(41)73)11-38-64(96)78-52(29-12-31(86)19-33(13-29)104-43-16-26(3-7-40(43)89)50(75)65(97)77-38)67(99)80-53(30)68(100)79-51-27-4-6-39(88)34(14-27)49-35(54(70(102)103)81-69(101)56(63)82-66(51)98)20-32(87)21-44(49)107-72-62(95)61(94)59(92)48(23-84)109-72/h2-10,12-21,38,47-48,50-56,58-63,71-72,83-84,86-95H,11,22-23,75H2,1H3,(H,76,85)(H,77,97)(H,78,96)(H,79,100)(H,80,99)(H,81,101)(H,82,98)(H,102,103)/t38-,47-,48-,50-,51-,52+,53-,54+,55-,56+,58-,59-,60-,61+,62+,63-,71+,72+/m1/s1
InChI key:InChIKey=SUFIXUDUKRJOBH-JSMFNTJWSA-N
SMILES:O(C1=C2C([C@@H](C(O)=O)NC(=O)[C@@]3([C@H](O[C@H]4[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O4)C=5C=C(Cl)C(=CC5)OC=6C=C7[C@](C(=O)N[C@](C=8C=C2C(O)=CC8)(C(=O)N3)[H])(NC(=O)[C@@]9(C=%10C=C(OC=%11C=C([C@@H](N)C(=O)N[C@@](C(=O)N9)(CC=%12C=C(Cl)C(OC(=C7)C6O)=CC%12)[H])C=CC%11O)C=C(O)C%10)[H])[H])[H])=CC(O)=C1)[C@H]%13O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]%13O
Synonyms:- Ristomycin A aglycone, 34-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-22,31-dichloro-7-demethyl-64-O-demethyl-19-deoxy-42-O-α-D-mannopyranosyl-
- Antibiotic L 17054
- 34-O-[2-(Acetylamino)-2-deoxy-β-D-glucopyranosyl]-22,31-dichloro-7-demethyl-64-O-demethyl-19-deoxy-42-O-α-D-mannopyranosylristomycin A aglycone
- 1H,15H,34H-20,23:30,33-Dietheno-3,18:35,48-bis(iminomethano)-4,8:10,14:25,28:43,47-tetrametheno-28H-[1,14,6,22]dioxadiazacyclooctacosino[4,5-m][10,2,16]benzoxadiazacyclotetracosine, ristomycin A aglycone deriv.
- Teicoplanin A 3-1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

